C30H27F5O3 — CID 140948335
(2,3,4,5,6-pentafluorophenyl) (1S,4aS,10aR)-1,4a-dimethyl-6-phenylmethoxy-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 140948335) has the molecular formula C30H27F5O3 and a molecular weight of 530.53 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (1S,4aS,10aR)-1,4a-dimethyl-6-phenylmethoxy-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (1S,4aS,10aR)-1,4a-dimethyl-6-phenylmethoxy-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 140948335 |
| Molecular Formula | C30H27F5O3 |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (1S,4aS,10aR)-1,4a-dimethyl-6-phenylmethoxy-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | C[C@]1(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)CCC[C@]2(C)c3cc(OCc4ccccc4)ccc3CC[C@@H]12 |
| InChI | InChI=1S/C30H27F5O3/c1-29-13-6-14-30(2,28(36)38-27-25(34)23(32)22(31)24(33)26(27)35)21(29)12-10-18-9-11-19(15-20(18)29)37-16-17-7-4-3-5-8-17/h3-5,7-9,11,15,21H,6,10,12-14,16H2,1-2H3/t21-,29-,30+/m1/s1 |
| InChIKey | VQUZLJMLRVMBFW-KSMSDSDGSA-N |
| XLogP | 7.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|