C27H31N3O3 — CID 54763561
methyl (1S,4aS,10aR)-1,4a-dimethyl-6-[(1-phenyltriazol-4-yl)methoxy]-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 54763561) has the molecular formula C27H31N3O3 and a molecular weight of 445.56 g/mol. Its IUPAC name is methyl (1S,4aS,10aR)-1,4a-dimethyl-6-[(1-phenyltriazol-4-yl)methoxy]-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (1S,4aS,10aR)-1,4a-dimethyl-6-[(1-phenyltriazol-4-yl)methoxy]-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 54763561 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | methyl (1S,4aS,10aR)-1,4a-dimethyl-6-[(1-phenyltriazol-4-yl)methoxy]-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCC[C@]2(C)c3cc(OCc4cn(-c5ccccc5)nn4)ccc3CC[C@@H]12 |
| InChI | InChI=1S/C27H31N3O3/c1-26-14-7-15-27(2,25(31)32-3)24(26)13-11-19-10-12-22(16-23(19)26)33-18-20-17-30(29-28-20)21-8-5-4-6-9-21/h4-6,8-10,12,16-17,24H,7,11,13-15,18H2,1-3H3/t24-,26-,27+/m1/s1 |
| InChIKey | HGEBQWAVOQIUMA-IEUSDUHPSA-N |
| XLogP | 5.03 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |