C24H29NO2 — CID 71666580
methyl (4aS)-6-anilino-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 71666580) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is methyl (4aS)-6-anilino-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (4aS)-6-anilino-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 71666580 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | methyl (4aS)-6-anilino-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)C1(C)CCC[C@]2(C)c3cc(Nc4ccccc4)ccc3CCC12 |
| InChI | InChI=1S/C24H29NO2/c1-23-14-7-15-24(2,22(26)27-3)21(23)13-11-17-10-12-19(16-20(17)23)25-18-8-5-4-6-9-18/h4-6,8-10,12,16,21,25H,7,11,13-15H2,1-3H3/t21?,23-,24?/m1/s1 |
| InChIKey | BMRNMYSSNSAQKW-SHSGKGFPSA-N |
| XLogP | 5.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |