C27H30N2O2 — CID 71666429
methyl (4aS)-1,4a-dimethyl-7-(quinolin-8-ylamino)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 71666429) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is methyl (4aS)-1,4a-dimethyl-7-(quinolin-8-ylamino)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (4aS)-1,4a-dimethyl-7-(quinolin-8-ylamino)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 71666429 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | methyl (4aS)-1,4a-dimethyl-7-(quinolin-8-ylamino)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)C1(C)CCC[C@]2(C)c3ccc(Nc4cccc5cccnc45)cc3CCC12 |
| InChI | InChI=1S/C27H30N2O2/c1-26-14-6-15-27(2,25(30)31-3)23(26)13-10-19-17-20(11-12-21(19)26)29-22-9-4-7-18-8-5-16-28-24(18)22/h4-5,7-9,11-12,16-17,23,29H,6,10,13-15H2,1-3H3/t23?,26-,27?/m1/s1 |
| InChIKey | AGMZBMJPIZBVIA-VJZLMVMKSA-N |
| XLogP | 6.16 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |