C17H21ClO — CID 144508012
1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carbonyl chloride (PubChem CID 144508012) has the molecular formula C17H21ClO and a molecular weight of 276.81 g/mol. Its IUPAC name is 1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carbonyl chloride.
| Compound Name | 1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carbonyl chloride |
|---|---|
| PubChem CID | 144508012 |
| Molecular Formula | C17H21ClO |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carbonyl chloride |
| SMILES | CC1(C(=O)Cl)CCCC2(C)c3ccccc3CCC12 |
| InChI | InChI=1S/C17H21ClO/c1-16-10-5-11-17(2,15(18)19)14(16)9-8-12-6-3-4-7-13(12)16/h3-4,6-7,14H,5,8-11H2,1-2H3 |
| InChIKey | HOYZMDVDRWOSAP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|