C16H19F3O — CID 11822169
(1S,4aS,10aR)-4a-methyl-1-(trifluoromethyl)-2,3,4,9,10,10a-hexahydrophenanthren-1-ol (PubChem CID 11822169) has the molecular formula C16H19F3O and a molecular weight of 284.32 g/mol. Its IUPAC name is (1S,4aS,10aR)-4a-methyl-1-(trifluoromethyl)-2,3,4,9,10,10a-hexahydrophenanthren-1-ol.
| Compound Name | (1S,4aS,10aR)-4a-methyl-1-(trifluoromethyl)-2,3,4,9,10,10a-hexahydrophenanthren-1-ol |
|---|---|
| PubChem CID | 11822169 |
| Molecular Formula | C16H19F3O |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (1S,4aS,10aR)-4a-methyl-1-(trifluoromethyl)-2,3,4,9,10,10a-hexahydrophenanthren-1-ol |
| SMILES | C[C@]12CCC[C@@](O)(C(F)(F)F)[C@@H]1CCc1ccccc12 |
| InChI | InChI=1S/C16H19F3O/c1-14-9-4-10-15(20,16(17,18)19)13(14)8-7-11-5-2-3-6-12(11)14/h2-3,5-6,13,20H,4,7-10H2,1H3/t13-,14-,15+/m1/s1 |
| InChIKey | SVXUSIAIBOVNLZ-KFWWJZLASA-N |
| XLogP | 3.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |