C19H24O3 — CID 15361598
ethyl (1R,4aR,10aS)-1,4a-dimethyl-2-oxo-4,9,10,10a-tetrahydro-3H-phenanthrene-1-carboxylate (PubChem CID 15361598) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is ethyl (1R,4aR,10aS)-1,4a-dimethyl-2-oxo-4,9,10,10a-tetrahydro-3H-phenanthrene-1-carboxylate.
| Compound Name | ethyl (1R,4aR,10aS)-1,4a-dimethyl-2-oxo-4,9,10,10a-tetrahydro-3H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 15361598 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | ethyl (1R,4aR,10aS)-1,4a-dimethyl-2-oxo-4,9,10,10a-tetrahydro-3H-phenanthrene-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)C(=O)CC[C@@]2(C)c3ccccc3CC[C@H]12 |
| InChI | InChI=1S/C19H24O3/c1-4-22-17(21)19(3)15-10-9-13-7-5-6-8-14(13)18(15,2)12-11-16(19)20/h5-8,15H,4,9-12H2,1-3H3/t15-,18-,19+/m0/s1 |
| InChIKey | ALCPEEXFSQPBAO-ZYSHUDEJSA-N |
| XLogP | 3.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|