C20H28O — CID 162820599
(4aS,10aR)-8-ethyl-1,1,4a,7-tetramethyl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one (PubChem CID 162820599) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is (4aS,10aR)-8-ethyl-1,1,4a,7-tetramethyl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one.
| Compound Name | (4aS,10aR)-8-ethyl-1,1,4a,7-tetramethyl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one |
|---|---|
| PubChem CID | 162820599 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | (4aS,10aR)-8-ethyl-1,1,4a,7-tetramethyl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one |
| SMILES | CCc1c(C)ccc2c1CC[C@H]1C(C)(C)C(=O)CC[C@]21C |
| InChI | InChI=1S/C20H28O/c1-6-14-13(2)7-9-16-15(14)8-10-17-19(3,4)18(21)11-12-20(16,17)5/h7,9,17H,6,8,10-12H2,1-5H3/t17-,20+/m0/s1 |
| InChIKey | RBAHQKBUVTZPPX-FXAWDEMLSA-N |
| XLogP | 4.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |