C20H24O3 — CID 163036462
(2S,7S,9S)-2,6,6,14-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),13,15-triene-5,11-dione (PubChem CID 163036462) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is (2S,7S,9S)-2,6,6,14-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),13,15-triene-5,11-dione.
| Compound Name | (2S,7S,9S)-2,6,6,14-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),13,15-triene-5,11-dione |
|---|---|
| PubChem CID | 163036462 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (2S,7S,9S)-2,6,6,14-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),13,15-triene-5,11-dione |
| SMILES | Cc1ccc2c3c1CC(=O)O[C@H]3C[C@@H]1C(C)(C)C(=O)CC[C@]21C |
| InChI | InChI=1S/C20H24O3/c1-11-5-6-13-18-12(11)9-17(22)23-14(18)10-15-19(2,3)16(21)7-8-20(13,15)4/h5-6,14-15H,7-10H2,1-4H3/t14-,15+,20+/m0/s1 |
| InChIKey | OAUYWWVMZLOVNK-BXTJHSDWSA-N |
| XLogP | 3.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |