C21H28O4 — CID 145185895
ethane;5-hydroxy-6-methoxy-7,9b-dimethyl-3,3b,4,5,10,11-hexahydronaphtho[2,1-e][2]benzofuran-1-one (PubChem CID 145185895) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is ethane;5-hydroxy-6-methoxy-7,9b-dimethyl-3,3b,4,5,10,11-hexahydronaphtho[2,1-e][2]benzofuran-1-one.
| Compound Name | ethane;5-hydroxy-6-methoxy-7,9b-dimethyl-3,3b,4,5,10,11-hexahydronaphtho[2,1-e][2]benzofuran-1-one |
|---|---|
| PubChem CID | 145185895 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | ethane;5-hydroxy-6-methoxy-7,9b-dimethyl-3,3b,4,5,10,11-hexahydronaphtho[2,1-e][2]benzofuran-1-one |
| SMILES | CC.COc1c(C)ccc2c1C(O)CC1C3=C(CCC21C)C(=O)OC3 |
| InChI | InChI=1S/C19H22O4.C2H6/c1-10-4-5-13-16(17(10)22-3)15(20)8-14-12-9-23-18(21)11(12)6-7-19(13,14)2;1-2/h4-5,14-15,20H,6-9H2,1-3H3;1-2H3 |
| InChIKey | OPOHUKVGSBANPK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |