C25H30O6 — CID 122695819
(3bR,9bS)-6-hydroxy-9b-methyl-7-[3-(oxan-2-yloxy)propyl]-3b,4,10,11-tetrahydro-3H-naphtho[2,1-e][2]benzofuran-1,5-dione (PubChem CID 122695819) has the molecular formula C25H30O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is (3bR,9bS)-6-hydroxy-9b-methyl-7-[3-(oxan-2-yloxy)propyl]-3b,4,10,11-tetrahydro-3H-naphtho[2,1-e][2]benzofuran-1,5-dione.
| Compound Name | (3bR,9bS)-6-hydroxy-9b-methyl-7-[3-(oxan-2-yloxy)propyl]-3b,4,10,11-tetrahydro-3H-naphtho[2,1-e][2]benzofuran-1,5-dione |
|---|---|
| PubChem CID | 122695819 |
| Molecular Formula | C25H30O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | (3bR,9bS)-6-hydroxy-9b-methyl-7-[3-(oxan-2-yloxy)propyl]-3b,4,10,11-tetrahydro-3H-naphtho[2,1-e][2]benzofuran-1,5-dione |
| SMILES | C[C@]12CCC3=C(COC3=O)[C@@H]1CC(=O)c1c2ccc(CCCOC2CCCCO2)c1O |
| InChI | InChI=1S/C25H30O6/c1-25-10-9-16-17(14-31-24(16)28)19(25)13-20(26)22-18(25)8-7-15(23(22)27)5-4-12-30-21-6-2-3-11-29-21/h7-8,19,21,27H,2-6,9-14H2,1H3/t19-,21?,25+/m0/s1 |
| InChIKey | QDFUXQGBZRNUPD-ZUSIFUOBSA-N |
| XLogP | 3.98 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|