C17H19BO2 — CID 87419221
CID 87419221 (PubChem CID 87419221) has the molecular formula C17H19BO2 and a molecular weight of 266.15 g/mol.
| Compound Name | CID 87419221 |
|---|---|
| PubChem CID | 87419221 |
| Molecular Formula | C17H19BO2 |
| Molecular Weight | 266.15 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(CCOC2CCCCO2)c2ccccc12 |
| InChI | InChI=1S/C17H19BO2/c18-16-9-8-13(14-5-1-2-6-15(14)16)10-12-20-17-7-3-4-11-19-17/h1-2,5-6,8-9,17H,3-4,7,10-12H2 |
| InChIKey | QFKIAZMZZKSZBL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.15 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|