C26H38O6 — CID 145185777
ethane;methyl 3-(5,6-dihydroxy-9b-methyl-1-oxo-3,3b,4,5,10,11-hexahydronaphtho[2,1-e][2]benzofuran-7-yl)butanoate (PubChem CID 145185777) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is ethane;methyl 3-(5,6-dihydroxy-9b-methyl-1-oxo-3,3b,4,5,10,11-hexahydronaphtho[2,1-e][2]benzofuran-7-yl)butanoate.
| Compound Name | ethane;methyl 3-(5,6-dihydroxy-9b-methyl-1-oxo-3,3b,4,5,10,11-hexahydronaphtho[2,1-e][2]benzofuran-7-yl)butanoate |
|---|---|
| PubChem CID | 145185777 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | ethane;methyl 3-(5,6-dihydroxy-9b-methyl-1-oxo-3,3b,4,5,10,11-hexahydronaphtho[2,1-e][2]benzofuran-7-yl)butanoate |
| SMILES | CC.CC.COC(=O)CC(C)c1ccc2c(c1O)C(O)CC1C3=C(CCC21C)C(=O)OC3 |
| InChI | InChI=1S/C22H26O6.2C2H6/c1-11(8-18(24)27-3)12-4-5-15-19(20(12)25)17(23)9-16-14-10-28-21(26)13(14)6-7-22(15,16)2;2*1-2/h4-5,11,16-17,23,25H,6-10H2,1-3H3;2*1-2H3 |
| InChIKey | GTEMZFZLRSVPQX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |