C22H28IO5P — CID 145185804
ethane;6-hydroxy-7-(3-iodophosphanyloxypropyl)-9b-methyl-3b,4,10,11-tetrahydro-3H-naphtho[2,1-e][2]benzofuran-1,5-dione (PubChem CID 145185804) has the molecular formula C22H28IO5P and a molecular weight of 530.34 g/mol. Its IUPAC name is ethane;6-hydroxy-7-(3-iodophosphanyloxypropyl)-9b-methyl-3b,4,10,11-tetrahydro-3H-naphtho[2,1-e][2]benzofuran-1,5-dione.
| Compound Name | ethane;6-hydroxy-7-(3-iodophosphanyloxypropyl)-9b-methyl-3b,4,10,11-tetrahydro-3H-naphtho[2,1-e][2]benzofuran-1,5-dione |
|---|---|
| PubChem CID | 145185804 |
| Molecular Formula | C22H28IO5P |
| Molecular Weight | 530.34 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | ethane;6-hydroxy-7-(3-iodophosphanyloxypropyl)-9b-methyl-3b,4,10,11-tetrahydro-3H-naphtho[2,1-e][2]benzofuran-1,5-dione |
| SMILES | CC.CC12CCC3=C(COC3=O)C1CC(=O)c1c2ccc(CCCOPI)c1O |
| InChI | InChI=1S/C20H22IO5P.C2H6/c1-20-7-6-12-13(10-25-19(12)24)15(20)9-16(22)17-14(20)5-4-11(18(17)23)3-2-8-26-27-21;1-2/h4-5,15,23,27H,2-3,6-10H2,1H3;1-2H3 |
| InChIKey | PIFJFJGBCNKLHQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.34 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|