C19H20O4 — CID 162950245
(3bR,9bS)-7-acetyl-6-hydroxy-9b-methyl-3,3b,4,5,10,11-hexahydronaphtho[2,1-e][2]benzofuran-1-one (PubChem CID 162950245) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is (3bR,9bS)-7-acetyl-6-hydroxy-9b-methyl-3,3b,4,5,10,11-hexahydronaphtho[2,1-e][2]benzofuran-1-one.
| Compound Name | (3bR,9bS)-7-acetyl-6-hydroxy-9b-methyl-3,3b,4,5,10,11-hexahydronaphtho[2,1-e][2]benzofuran-1-one |
|---|---|
| PubChem CID | 162950245 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (3bR,9bS)-7-acetyl-6-hydroxy-9b-methyl-3,3b,4,5,10,11-hexahydronaphtho[2,1-e][2]benzofuran-1-one |
| SMILES | CC(=O)c1ccc2c(c1O)CC[C@H]1C3=C(CC[C@]21C)C(=O)OC3 |
| InChI | InChI=1S/C19H20O4/c1-10(20)11-3-5-15-13(17(11)21)4-6-16-14-9-23-18(22)12(14)7-8-19(15,16)2/h3,5,16,21H,4,6-9H2,1-2H3/t16-,19+/m0/s1 |
| InChIKey | ZCYQXTZWTXAFIF-QFBILLFUSA-N |
| XLogP | 3.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |