C18H19IO3 — CID 102531097
(3bR,9bS)-7-iodo-6-methoxy-9b-methyl-3,3b,4,5,10,11-hexahydronaphtho[2,1-e][2]benzofuran-1-one (PubChem CID 102531097) has the molecular formula C18H19IO3 and a molecular weight of 410.25 g/mol. Its IUPAC name is (3bR,9bS)-7-iodo-6-methoxy-9b-methyl-3,3b,4,5,10,11-hexahydronaphtho[2,1-e][2]benzofuran-1-one.
| Compound Name | (3bR,9bS)-7-iodo-6-methoxy-9b-methyl-3,3b,4,5,10,11-hexahydronaphtho[2,1-e][2]benzofuran-1-one |
|---|---|
| PubChem CID | 102531097 |
| Molecular Formula | C18H19IO3 |
| Molecular Weight | 410.25 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | (3bR,9bS)-7-iodo-6-methoxy-9b-methyl-3,3b,4,5,10,11-hexahydronaphtho[2,1-e][2]benzofuran-1-one |
| SMILES | COc1c(I)ccc2c1CC[C@H]1C3=C(CC[C@]21C)C(=O)OC3 |
| InChI | InChI=1S/C18H19IO3/c1-18-8-7-10-12(9-22-17(10)20)14(18)4-3-11-13(18)5-6-15(19)16(11)21-2/h5-6,14H,3-4,7-9H2,1-2H3/t14-,18+/m0/s1 |
| InChIKey | MXUWUZPBIFCZON-KBXCAEBGSA-N |
| XLogP | 3.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.25 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|