C17H23NO2 — CID 10492507
(5aS,11bS)-8-methoxy-4,11b-dimethyl-1,2,3,5a,6,7-hexahydrobenzo[g][2]benzazepin-5-one (PubChem CID 10492507) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (5aS,11bS)-8-methoxy-4,11b-dimethyl-1,2,3,5a,6,7-hexahydrobenzo[g][2]benzazepin-5-one.
| Compound Name | (5aS,11bS)-8-methoxy-4,11b-dimethyl-1,2,3,5a,6,7-hexahydrobenzo[g][2]benzazepin-5-one |
|---|---|
| PubChem CID | 10492507 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (5aS,11bS)-8-methoxy-4,11b-dimethyl-1,2,3,5a,6,7-hexahydrobenzo[g][2]benzazepin-5-one |
| SMILES | COc1cccc2c1CC[C@@H]1C(=O)N(C)CCC[C@]21C |
| InChI | InChI=1S/C17H23NO2/c1-17-10-5-11-18(2)16(19)14(17)9-8-12-13(17)6-4-7-15(12)20-3/h4,6-7,14H,5,8-11H2,1-3H3/t14-,17-/m1/s1 |
| InChIKey | RVXZRDYPZFXJTB-RHSMWYFYSA-N |
| XLogP | 2.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |