C17H23NO2 — CID 86736363
(5aR,8aS)-5a-(3-methoxyphenyl)-2-methyl-4,5,6,7,8,8a-hexahydro-3H-cyclopenta[c]azepin-1-one (PubChem CID 86736363) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (5aR,8aS)-5a-(3-methoxyphenyl)-2-methyl-4,5,6,7,8,8a-hexahydro-3H-cyclopenta[c]azepin-1-one.
| Compound Name | (5aR,8aS)-5a-(3-methoxyphenyl)-2-methyl-4,5,6,7,8,8a-hexahydro-3H-cyclopenta[c]azepin-1-one |
|---|---|
| PubChem CID | 86736363 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (5aR,8aS)-5a-(3-methoxyphenyl)-2-methyl-4,5,6,7,8,8a-hexahydro-3H-cyclopenta[c]azepin-1-one |
| SMILES | COc1cccc([C@@]23CCC[C@@H]2C(=O)N(C)CCC3)c1 |
| InChI | InChI=1S/C17H23NO2/c1-18-11-5-10-17(9-4-8-15(17)16(18)19)13-6-3-7-14(12-13)20-2/h3,6-7,12,15H,4-5,8-11H2,1-2H3/t15-,17+/m1/s1 |
| InChIKey | YTMRJVJWLYJPEU-WBVHZDCISA-N |
| XLogP | 2.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |