C18H23NO2 — CID 10424075
(4aR,6R,8aR)-4a-(3-methoxyphenyl)-2,6-dimethyl-4,5,6,8a-tetrahydro-3H-isoquinolin-1-one (PubChem CID 10424075) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is (4aR,6R,8aR)-4a-(3-methoxyphenyl)-2,6-dimethyl-4,5,6,8a-tetrahydro-3H-isoquinolin-1-one.
| Compound Name | (4aR,6R,8aR)-4a-(3-methoxyphenyl)-2,6-dimethyl-4,5,6,8a-tetrahydro-3H-isoquinolin-1-one |
|---|---|
| PubChem CID | 10424075 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (4aR,6R,8aR)-4a-(3-methoxyphenyl)-2,6-dimethyl-4,5,6,8a-tetrahydro-3H-isoquinolin-1-one |
| SMILES | COc1cccc([C@]23CCN(C)C(=O)[C@@H]2C=C[C@H](C)C3)c1 |
| InChI | InChI=1S/C18H23NO2/c1-13-7-8-16-17(20)19(2)10-9-18(16,12-13)14-5-4-6-15(11-14)21-3/h4-8,11,13,16H,9-10,12H2,1-3H3/t13-,16-,18+/m0/s1 |
| InChIKey | PUHKISLZSDNGOT-QANKJYHBSA-N |
| XLogP | 3.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|