C21H31NO — CID 22807503
(4aS,8aR)-2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-6-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinoline (PubChem CID 22807503) has the molecular formula C21H31NO and a molecular weight of 313.49 g/mol. Its IUPAC name is (4aS,8aR)-2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-6-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinoline.
| Compound Name | (4aS,8aR)-2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-6-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinoline |
|---|---|
| PubChem CID | 22807503 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | (4aS,8aR)-2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-6-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinoline |
| SMILES | COc1cccc([C@@]23CCN(CC4CC4)C[C@@H]2CCC(C)C3)c1 |
| InChI | InChI=1S/C21H31NO/c1-16-6-9-19-15-22(14-17-7-8-17)11-10-21(19,13-16)18-4-3-5-20(12-18)23-2/h3-5,12,16-17,19H,6-11,13-15H2,1-2H3/t16?,19-,21-/m0/s1 |
| InChIKey | BRCVHFYVQJOMTA-BPWGJPQNSA-N |
| XLogP | 4.48 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |