C32H42Cl2N2O2 — CID 70336906
N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide (PubChem CID 70336906) has the molecular formula C32H42Cl2N2O2 and a molecular weight of 557.61 g/mol. Its IUPAC name is N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide.
| Compound Name | N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 70336906 |
| Molecular Formula | C32H42Cl2N2O2 |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-(2-methylpropyl)acetamide |
| SMILES | COc1cccc([C@@]23CCN(CC4CC4)C[C@H]2CC[C@H](N(CC(C)C)C(=O)Cc2ccc(Cl)c(Cl)c2)C3)c1 |
| InChI | InChI=1S/C32H42Cl2N2O2/c1-22(2)19-36(31(37)16-24-9-12-29(33)30(34)15-24)27-11-10-26-21-35(20-23-7-8-23)14-13-32(26,18-27)25-5-4-6-28(17-25)38-3/h4-6,9,12,15,17,22-23,26-27H,7-8,10-11,13-14,16,18-21H2,1-3H3/t26-,27+,32+/m1/s1 |
| InChIKey | FAEOXKLJUXQVAV-CUJVHAHTSA-N |
| XLogP | 7.25 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |