C29H36Cl2N2O3 — CID 67728063
N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-8-hydroxy-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide (PubChem CID 67728063) has the molecular formula C29H36Cl2N2O3 and a molecular weight of 531.52 g/mol. Its IUPAC name is N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-8-hydroxy-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide.
| Compound Name | N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-8-hydroxy-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide |
|---|---|
| PubChem CID | 67728063 |
| Molecular Formula | C29H36Cl2N2O3 |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-8-hydroxy-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide |
| SMILES | COc1cccc([C@@]23CCN(CC4CC4)C[C@H]2C(O)C[C@@H](N(C)C(=O)Cc2ccc(Cl)c(Cl)c2)C3)c1 |
| InChI | InChI=1S/C29H36Cl2N2O3/c1-32(28(35)13-20-8-9-25(30)26(31)12-20)22-15-27(34)24-18-33(17-19-6-7-19)11-10-29(24,16-22)21-4-3-5-23(14-21)36-2/h3-5,8-9,12,14,19,22,24,27,34H,6-7,10-11,13,15-18H2,1-2H3/t22-,24+,27?,29+/m1/s1 |
| InChIKey | QRKNMLYBLIFJDJ-ZWRPHDHQSA-N |
| XLogP | 5.20 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |