C28H34Cl2N2O3 — CID 67728911
N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-8-hydroxy-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide (PubChem CID 67728911) has the molecular formula C28H34Cl2N2O3 and a molecular weight of 517.50 g/mol. Its IUPAC name is N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-8-hydroxy-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide.
| Compound Name | N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-8-hydroxy-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 67728911 |
| Molecular Formula | C28H34Cl2N2O3 |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-8-hydroxy-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide |
| SMILES | COc1cccc([C@@]23CCN(CC4CC4)C[C@H]2C(O)C[C@@H](NC(=O)Cc2ccc(Cl)c(Cl)c2)C3)c1 |
| InChI | InChI=1S/C28H34Cl2N2O3/c1-35-22-4-2-3-20(13-22)28-9-10-32(16-18-5-6-18)17-23(28)26(33)14-21(15-28)31-27(34)12-19-7-8-24(29)25(30)11-19/h2-4,7-8,11,13,18,21,23,26,33H,5-6,9-10,12,14-17H2,1H3,(H,31,34)/t21-,23+,26?,28+/m1/s1 |
| InChIKey | OUZQHSFYDZGYPF-XZDSOHDBSA-N |
| XLogP | 4.85 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |