C29H34Cl2N2O4 — CID 57050220
[3-[6-[[2-(3,4-dichlorophenyl)acetyl]amino]-8-methoxy-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate (PubChem CID 57050220) has the molecular formula C29H34Cl2N2O4 and a molecular weight of 545.51 g/mol. Its IUPAC name is [3-[6-[[2-(3,4-dichlorophenyl)acetyl]amino]-8-methoxy-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate.
| Compound Name | [3-[6-[[2-(3,4-dichlorophenyl)acetyl]amino]-8-methoxy-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 57050220 |
| Molecular Formula | C29H34Cl2N2O4 |
| Molecular Weight | 545.51 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | [3-[6-[[2-(3,4-dichlorophenyl)acetyl]amino]-8-methoxy-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
| SMILES | C=CCN1CCC2(c3cccc(OC(C)=O)c3)CC(NC(=O)Cc3ccc(Cl)c(Cl)c3)CC(OC)C2C1 |
| InChI | InChI=1S/C29H34Cl2N2O4/c1-4-11-33-12-10-29(21-6-5-7-23(15-21)37-19(2)34)17-22(16-27(36-3)24(29)18-33)32-28(35)14-20-8-9-25(30)26(31)13-20/h4-9,13,15,22,24,27H,1,10-12,14,16-18H2,2-3H3,(H,32,35) |
| InChIKey | JDNRTAIKGWVYOP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|