C29H36Cl2N2O3 — CID 70338790
2-(3,4-dichlorophenyl)-N-[8-methoxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylacetamide (PubChem CID 70338790) has the molecular formula C29H36Cl2N2O3 and a molecular weight of 531.52 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[8-methoxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylacetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[8-methoxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 70338790 |
| Molecular Formula | C29H36Cl2N2O3 |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[8-methoxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylacetamide |
| SMILES | C=CCN1CCC2(c3cccc(OC)c3)CC(N(C)C(=O)Cc3ccc(Cl)c(Cl)c3)CC(OC)C2C1 |
| InChI | InChI=1S/C29H36Cl2N2O3/c1-5-12-33-13-11-29(21-7-6-8-23(16-21)35-3)18-22(17-27(36-4)24(29)19-33)32(2)28(34)15-20-9-10-25(30)26(31)14-20/h5-10,14,16,22,24,27H,1,11-13,15,17-19H2,2-4H3 |
| InChIKey | UOOUBOIKECAHQC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|