C28H36N2O3 — CID 56991110
N-[(4aR,6R,8aS)-8-methoxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylbenzamide (PubChem CID 56991110) has the molecular formula C28H36N2O3 and a molecular weight of 448.61 g/mol. Its IUPAC name is N-[(4aR,6R,8aS)-8-methoxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylbenzamide.
| Compound Name | N-[(4aR,6R,8aS)-8-methoxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 56991110 |
| Molecular Formula | C28H36N2O3 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | N-[(4aR,6R,8aS)-8-methoxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylbenzamide |
| SMILES | C=CCN1CC[C@@]2(c3cccc(OC)c3)C[C@@H](N(C)C(=O)c3ccccc3)CC(OC)[C@@H]2C1 |
| InChI | InChI=1S/C28H36N2O3/c1-5-15-30-16-14-28(22-12-9-13-24(17-22)32-3)19-23(18-26(33-4)25(28)20-30)29(2)27(31)21-10-7-6-8-11-21/h5-13,17,23,25-26H,1,14-16,18-20H2,2-4H3/t23-,25-,26?,28-/m0/s1 |
| InChIKey | YBTJYUUFAOFWEW-XGFAVYLRSA-N |
| XLogP | 4.39 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|