C29H38N2O3 — CID 56991581
N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-8-methoxy-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylbenzamide (PubChem CID 56991581) has the molecular formula C29H38N2O3 and a molecular weight of 462.63 g/mol. Its IUPAC name is N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-8-methoxy-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylbenzamide.
| Compound Name | N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-8-methoxy-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 56991581 |
| Molecular Formula | C29H38N2O3 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | N-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-8-methoxy-4a-(3-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methylbenzamide |
| SMILES | COc1cccc([C@@]23CCN(CC4CC4)C[C@H]2C(OC)C[C@@H](N(C)C(=O)c2ccccc2)C3)c1 |
| InChI | InChI=1S/C29H38N2O3/c1-30(28(32)22-8-5-4-6-9-22)24-17-27(34-3)26-20-31(19-21-12-13-21)15-14-29(26,18-24)23-10-7-11-25(16-23)33-2/h4-11,16,21,24,26-27H,12-15,17-20H2,1-3H3/t24-,26+,27?,29+/m1/s1 |
| InChIKey | MPICVVAUQQFQHJ-NKSNWLFFSA-N |
| XLogP | 4.61 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |