C31H44N2O3 — CID 67729040
N-[(4aR,6S,8aS)-8-methoxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methyl-6-phenylhexanamide (PubChem CID 67729040) has the molecular formula C31H44N2O3 and a molecular weight of 492.70 g/mol. Its IUPAC name is N-[(4aR,6S,8aS)-8-methoxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methyl-6-phenylhexanamide.
| Compound Name | N-[(4aR,6S,8aS)-8-methoxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methyl-6-phenylhexanamide |
|---|---|
| PubChem CID | 67729040 |
| Molecular Formula | C31H44N2O3 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.34 |
| IUPAC Name | N-[(4aR,6S,8aS)-8-methoxy-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methyl-6-phenylhexanamide |
| SMILES | COc1cccc([C@@]23CCN(C)C[C@H]2C(OC)C[C@@H](N(C)C(=O)CCCCCc2ccccc2)C3)c1 |
| InChI | InChI=1S/C31H44N2O3/c1-32-19-18-31(25-15-11-16-27(20-25)35-3)22-26(21-29(36-4)28(31)23-32)33(2)30(34)17-10-6-9-14-24-12-7-5-8-13-24/h5,7-8,11-13,15-16,20,26,28-29H,6,9-10,14,17-19,21-23H2,1-4H3/t26-,28+,29?,31+/m1/s1 |
| InChIKey | IJTVITBAYYLDEB-DDVKJDPESA-N |
| XLogP | 5.32 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|