C33H44N2O5 — CID 67727870
[(4aR,6S,8aS)-4a-(3-acetyloxyphenyl)-2-methyl-6-[methyl(6-phenylhexanoyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate (PubChem CID 67727870) has the molecular formula C33H44N2O5 and a molecular weight of 548.72 g/mol. Its IUPAC name is [(4aR,6S,8aS)-4a-(3-acetyloxyphenyl)-2-methyl-6-[methyl(6-phenylhexanoyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate.
| Compound Name | [(4aR,6S,8aS)-4a-(3-acetyloxyphenyl)-2-methyl-6-[methyl(6-phenylhexanoyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
|---|---|
| PubChem CID | 67727870 |
| Molecular Formula | C33H44N2O5 |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.33 |
| IUPAC Name | [(4aR,6S,8aS)-4a-(3-acetyloxyphenyl)-2-methyl-6-[methyl(6-phenylhexanoyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
| SMILES | CC(=O)Oc1cccc([C@@]23CCN(C)C[C@H]2C(OC(C)=O)C[C@@H](N(C)C(=O)CCCCCc2ccccc2)C3)c1 |
| InChI | InChI=1S/C33H44N2O5/c1-24(36)39-29-16-11-15-27(20-29)33-18-19-34(3)23-30(33)31(40-25(2)37)21-28(22-33)35(4)32(38)17-10-6-9-14-26-12-7-5-8-13-26/h5,7-8,11-13,15-16,20,28,30-31H,6,9-10,14,17-19,21-23H2,1-4H3/t28-,30+,31?,33+/m1/s1 |
| InChIKey | DYOOHWXFMZXQBP-XXUKCURGSA-N |
| XLogP | 5.16 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|