C37H52N2O4 — CID 67728324
[(4aR,6R,8aS)-4a-(3-methoxyphenyl)-6-[2-methylpropyl(6-phenylhexanoyl)amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate (PubChem CID 67728324) has the molecular formula C37H52N2O4 and a molecular weight of 588.83 g/mol. Its IUPAC name is [(4aR,6R,8aS)-4a-(3-methoxyphenyl)-6-[2-methylpropyl(6-phenylhexanoyl)amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate.
| Compound Name | [(4aR,6R,8aS)-4a-(3-methoxyphenyl)-6-[2-methylpropyl(6-phenylhexanoyl)amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
|---|---|
| PubChem CID | 67728324 |
| Molecular Formula | C37H52N2O4 |
| Molecular Weight | 588.83 g/mol |
| Exact Mass | 588.39 |
| IUPAC Name | [(4aR,6R,8aS)-4a-(3-methoxyphenyl)-6-[2-methylpropyl(6-phenylhexanoyl)amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
| SMILES | C=CCN1CC[C@@]2(c3cccc(OC)c3)C[C@@H](N(CC(C)C)C(=O)CCCCCc3ccccc3)CC(OC(C)=O)[C@@H]2C1 |
| InChI | InChI=1S/C37H52N2O4/c1-6-21-38-22-20-37(31-17-13-18-33(23-31)42-5)25-32(24-35(34(37)27-38)43-29(4)40)39(26-28(2)3)36(41)19-12-8-11-16-30-14-9-7-10-15-30/h6-7,9-10,13-15,17-18,23,28,32,34-35H,1,8,11-12,16,19-22,24-27H2,2-5H3/t32-,34-,35?,37-/m0/s1 |
| InChIKey | JJUHKDOGWKOJPP-WRSBZMCQSA-N |
| XLogP | 6.82 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.83 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|