C33H44N2O4 — CID 22441373
[4a-(3-methoxyphenyl)-6-(6-phenylhexanoylamino)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate (PubChem CID 22441373) has the molecular formula C33H44N2O4 and a molecular weight of 532.73 g/mol. Its IUPAC name is [4a-(3-methoxyphenyl)-6-(6-phenylhexanoylamino)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate.
| Compound Name | [4a-(3-methoxyphenyl)-6-(6-phenylhexanoylamino)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
|---|---|
| PubChem CID | 22441373 |
| Molecular Formula | C33H44N2O4 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.33 |
| IUPAC Name | [4a-(3-methoxyphenyl)-6-(6-phenylhexanoylamino)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
| SMILES | C=CCN1CCC2(c3cccc(OC)c3)CC(NC(=O)CCCCCc3ccccc3)CC(OC(C)=O)C2C1 |
| InChI | InChI=1S/C33H44N2O4/c1-4-19-35-20-18-33(27-15-11-16-29(21-27)38-3)23-28(22-31(30(33)24-35)39-25(2)36)34-32(37)17-10-6-9-14-26-12-7-5-8-13-26/h4-5,7-8,11-13,15-16,21,28,30-31H,1,6,9-10,14,17-20,22-24H2,2-3H3,(H,34,37) |
| InChIKey | TWVAKUIWQADJBG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|