C32H44N2O3 — CID 23211848
N-[8a-methoxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-6-phenylhexanamide (PubChem CID 23211848) has the molecular formula C32H44N2O3 and a molecular weight of 504.72 g/mol. Its IUPAC name is N-[8a-methoxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-6-phenylhexanamide.
| Compound Name | N-[8a-methoxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-6-phenylhexanamide |
|---|---|
| PubChem CID | 23211848 |
| Molecular Formula | C32H44N2O3 |
| Molecular Weight | 504.72 g/mol |
| Exact Mass | 504.34 |
| IUPAC Name | N-[8a-methoxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-6-phenylhexanamide |
| SMILES | C=CCN1CCC2(c3cccc(OC)c3)CC(NC(=O)CCCCCc3ccccc3)CCC2(OC)C1 |
| InChI | InChI=1S/C32H44N2O3/c1-4-21-34-22-20-31(27-15-11-16-29(23-27)36-2)24-28(18-19-32(31,25-34)37-3)33-30(35)17-10-6-9-14-26-12-7-5-8-13-26/h4-5,7-8,11-13,15-16,23,28H,1,6,9-10,14,17-22,24-25H2,2-3H3,(H,33,35) |
| InChIKey | OLFSHSBTDLTZGG-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.72 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|