C34H49N2O3+ — CID 67670139
N-[(2R,4aS,6S)-2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]-6-phenylhexanamide (PubChem CID 67670139) has the molecular formula C34H49N2O3+ and a molecular weight of 533.78 g/mol. Its IUPAC name is N-[(2R,4aS,6S)-2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]-6-phenylhexanamide.
| Compound Name | N-[(2R,4aS,6S)-2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]-6-phenylhexanamide |
|---|---|
| PubChem CID | 67670139 |
| Molecular Formula | C34H49N2O3+ |
| Molecular Weight | 533.78 g/mol |
| Exact Mass | 533.37 |
| IUPAC Name | N-[(2R,4aS,6S)-2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]-6-phenylhexanamide |
| SMILES | COc1cccc([C@@]23CC[N@+](C)(CC4CC4)CC2(OC)CC[C@H](NC(=O)CCCCCc2ccccc2)C3)c1 |
| InChI | InChI=1S/C34H48N2O3/c1-36(25-28-17-18-28)22-21-33(29-14-10-15-31(23-29)38-2)24-30(19-20-34(33,26-36)39-3)35-32(37)16-9-5-8-13-27-11-6-4-7-12-27/h4,6-7,10-12,14-15,23,28,30H,5,8-9,13,16-22,24-26H2,1-3H3/p+1/t30-,33-,34?,36+/m0/s1 |
| InChIKey | DZFOYSPHHYVZKK-FZTIYVOUSA-O |
| XLogP | 6.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.78 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|