C32H47N2O2+ — CID 67670800
3-[(2R,4aS,6S)-8a-methoxy-2-methyl-6-(6-phenylhexylamino)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-4a-yl]phenol (PubChem CID 67670800) has the molecular formula C32H47N2O2+ and a molecular weight of 491.74 g/mol. Its IUPAC name is 3-[(2R,4aS,6S)-8a-methoxy-2-methyl-6-(6-phenylhexylamino)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-4a-yl]phenol.
| Compound Name | 3-[(2R,4aS,6S)-8a-methoxy-2-methyl-6-(6-phenylhexylamino)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-4a-yl]phenol |
|---|---|
| PubChem CID | 67670800 |
| Molecular Formula | C32H47N2O2+ |
| Molecular Weight | 491.74 g/mol |
| Exact Mass | 491.36 |
| IUPAC Name | 3-[(2R,4aS,6S)-8a-methoxy-2-methyl-6-(6-phenylhexylamino)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-4a-yl]phenol |
| SMILES | C=CC[N@@+]1(C)CC[C@@]2(c3cccc(O)c3)C[C@@H](NCCCCCCc3ccccc3)CCC2(OC)C1 |
| InChI | InChI=1S/C32H46N2O2/c1-4-22-34(2)23-20-31(28-16-12-17-30(35)24-28)25-29(18-19-32(31,26-34)36-3)33-21-11-6-5-8-13-27-14-9-7-10-15-27/h4,7,9-10,12,14-17,24,29,33H,1,5-6,8,11,13,18-23,25-26H2,2-3H3/p+1/t29-,31-,32?,34-/m0/s1 |
| InChIKey | RLKXHXONAGMOPO-DAYLNJLMSA-O |
| XLogP | 6.00 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.74 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|