C29H35Cl2N2O4+ — CID 67669821
[(2R,4aS,6S)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-4a-(3-hydroxyphenyl)-2-methyl-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-8a-yl] acetate (PubChem CID 67669821) has the molecular formula C29H35Cl2N2O4+ and a molecular weight of 546.52 g/mol. Its IUPAC name is [(2R,4aS,6S)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-4a-(3-hydroxyphenyl)-2-methyl-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-8a-yl] acetate.
| Compound Name | [(2R,4aS,6S)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-4a-(3-hydroxyphenyl)-2-methyl-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-8a-yl] acetate |
|---|---|
| PubChem CID | 67669821 |
| Molecular Formula | C29H35Cl2N2O4+ |
| Molecular Weight | 546.52 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | [(2R,4aS,6S)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-4a-(3-hydroxyphenyl)-2-methyl-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-8a-yl] acetate |
| SMILES | C=CC[N@@+]1(C)CC[C@@]2(c3cccc(O)c3)C[C@@H](NC(=O)Cc3ccc(Cl)c(Cl)c3)CCC2(OC(C)=O)C1 |
| InChI | InChI=1S/C29H34Cl2N2O4/c1-4-13-33(3)14-12-28(22-6-5-7-24(35)17-22)18-23(10-11-29(28,19-33)37-20(2)34)32-27(36)16-21-8-9-25(30)26(31)15-21/h4-9,15,17,23H,1,10-14,16,18-19H2,2-3H3,(H-,32,35,36)/p+1/t23-,28-,29?,33-/m0/s1 |
| InChIKey | OOSDXNIWBVEZQE-CKWNHQOASA-O |
| XLogP | 5.19 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|