C26H30Cl2N2O3 — CID 70336600
N-[(6S)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide (PubChem CID 70336600) has the molecular formula C26H30Cl2N2O3 and a molecular weight of 489.44 g/mol. Its IUPAC name is N-[(6S)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide.
| Compound Name | N-[(6S)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 70336600 |
| Molecular Formula | C26H30Cl2N2O3 |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | N-[(6S)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide |
| SMILES | C=CCN1CCC2(c3cccc(O)c3)C[C@@H](NC(=O)Cc3ccc(Cl)c(Cl)c3)CCC2(O)C1 |
| InChI | InChI=1S/C26H30Cl2N2O3/c1-2-11-30-12-10-25(19-4-3-5-21(31)15-19)16-20(8-9-26(25,33)17-30)29-24(32)14-18-6-7-22(27)23(28)13-18/h2-7,13,15,20,31,33H,1,8-12,14,16-17H2,(H,29,32)/t20-,25?,26?/m0/s1 |
| InChIKey | NYEOYQWCRWSQDJ-WOEOTAOXSA-N |
| XLogP | 4.47 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|