C28H34Cl2N2O3 — CID 70340197
N-[(6S)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide (PubChem CID 70340197) has the molecular formula C28H34Cl2N2O3 and a molecular weight of 517.50 g/mol. Its IUPAC name is N-[(6S)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide.
| Compound Name | N-[(6S)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 70340197 |
| Molecular Formula | C28H34Cl2N2O3 |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | N-[(6S)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide |
| SMILES | COC12CC[C@H](NC(=O)Cc3ccc(Cl)c(Cl)c3)CC1(c1cccc(O)c1)CCN(CC1CC1)C2 |
| InChI | InChI=1S/C28H34Cl2N2O3/c1-35-28-10-9-22(31-26(34)14-20-7-8-24(29)25(30)13-20)16-27(28,21-3-2-4-23(33)15-21)11-12-32(18-28)17-19-5-6-19/h2-4,7-8,13,15,19,22,33H,5-6,9-12,14,16-18H2,1H3,(H,31,34)/t22-,27?,28?/m0/s1 |
| InChIKey | PFDHJRQSXXWFPK-ZJOVHXHXSA-N |
| XLogP | 5.35 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |