C27H33BrN2O3S — CID 67670049
N-[(4aS,6S,8aR)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-(4-bromothiophen-2-yl)prop-2-enamide (PubChem CID 67670049) has the molecular formula C27H33BrN2O3S and a molecular weight of 545.54 g/mol. Its IUPAC name is N-[(4aS,6S,8aR)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-(4-bromothiophen-2-yl)prop-2-enamide.
| Compound Name | N-[(4aS,6S,8aR)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-(4-bromothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 67670049 |
| Molecular Formula | C27H33BrN2O3S |
| Molecular Weight | 545.54 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | N-[(4aS,6S,8aR)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-(4-bromothiophen-2-yl)prop-2-enamide |
| SMILES | CO[C@]12CC[C@H](NC(=O)C=Cc3cc(Br)cs3)C[C@]1(c1cccc(O)c1)CCN(CC1CC1)C2 |
| InChI | InChI=1S/C27H33BrN2O3S/c1-33-27-10-9-22(29-25(32)8-7-24-14-21(28)17-34-24)15-26(27,20-3-2-4-23(31)13-20)11-12-30(18-27)16-19-5-6-19/h2-4,7-8,13-14,17,19,22,31H,5-6,9-12,15-16,18H2,1H3,(H,29,32)/t22-,26-,27-/m0/s1 |
| InChIKey | NPNDDKDUOVTSSK-CAVYSCNFSA-N |
| XLogP | 5.34 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|