C29H38N2O4 — CID 67728039
(E)-N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-(2-methylfuran-3-yl)prop-2-enamide (PubChem CID 67728039) has the molecular formula C29H38N2O4 and a molecular weight of 478.63 g/mol. Its IUPAC name is (E)-N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-(2-methylfuran-3-yl)prop-2-enamide.
| Compound Name | (E)-N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-(2-methylfuran-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 67728039 |
| Molecular Formula | C29H38N2O4 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | (E)-N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-(2-methylfuran-3-yl)prop-2-enamide |
| SMILES | COc1cccc([C@@]23CCN(CC4CC4)C[C@@]2(OC)CC[C@@H](NC(=O)/C=C/c2ccoc2C)C3)c1 |
| InChI | InChI=1S/C29H38N2O4/c1-21-23(12-16-35-21)9-10-27(32)30-25-11-13-29(34-3)20-31(19-22-7-8-22)15-14-28(29,18-25)24-5-4-6-26(17-24)33-2/h4-6,9-10,12,16-17,22,25H,7-8,11,13-15,18-20H2,1-3H3,(H,30,32)/b10-9+/t25-,28+,29+/m1/s1 |
| InChIKey | ICFNKJSADOGOED-OMCXHZOFSA-N |
| XLogP | 4.72 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|