C29H36Cl2N2O3 — CID 70340740
N-[(6S)-2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide (PubChem CID 70340740) has the molecular formula C29H36Cl2N2O3 and a molecular weight of 531.52 g/mol. Its IUPAC name is N-[(6S)-2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide.
| Compound Name | N-[(6S)-2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 70340740 |
| Molecular Formula | C29H36Cl2N2O3 |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | N-[(6S)-2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide |
| SMILES | COc1cccc(C23CCN(CC4CC4)CC2(OC)CC[C@H](NC(=O)Cc2ccc(Cl)c(Cl)c2)C3)c1 |
| InChI | InChI=1S/C29H36Cl2N2O3/c1-35-24-5-3-4-22(16-24)28-12-13-33(18-20-6-7-20)19-29(28,36-2)11-10-23(17-28)32-27(34)15-21-8-9-25(30)26(31)14-21/h3-5,8-9,14,16,20,23H,6-7,10-13,15,17-19H2,1-2H3,(H,32,34)/t23-,28?,29?/m0/s1 |
| InChIKey | NZMDVCHVJVUXHO-SAVAPUMLSA-N |
| XLogP | 5.65 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |