C29H34Cl2N2O4 — CID 18662008
[(4aS,6S,8aR)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-4a-(3-methoxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate (PubChem CID 18662008) has the molecular formula C29H34Cl2N2O4 and a molecular weight of 545.51 g/mol. Its IUPAC name is [(4aS,6S,8aR)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-4a-(3-methoxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate.
| Compound Name | [(4aS,6S,8aR)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-4a-(3-methoxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate |
|---|---|
| PubChem CID | 18662008 |
| Molecular Formula | C29H34Cl2N2O4 |
| Molecular Weight | 545.51 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | [(4aS,6S,8aR)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-4a-(3-methoxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate |
| SMILES | C=CCN1CC[C@@]2(c3cccc(OC)c3)C[C@@H](NC(=O)Cc3ccc(Cl)c(Cl)c3)CC[C@]2(OC(C)=O)C1 |
| InChI | InChI=1S/C29H34Cl2N2O4/c1-4-13-33-14-12-28(22-6-5-7-24(17-22)36-3)18-23(10-11-29(28,19-33)37-20(2)34)32-27(35)16-21-8-9-25(30)26(31)15-21/h4-9,15,17,23H,1,10-14,16,18-19H2,2-3H3,(H,32,35)/t23-,28-,29-/m0/s1 |
| InChIKey | BGZWBNMDQQXINO-OIFPXGRLSA-N |
| XLogP | 5.34 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.51 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|