C30H36Cl2N2O4 — CID 70339172
[(6S)-2-(cyclopropylmethyl)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate (PubChem CID 70339172) has the molecular formula C30H36Cl2N2O4 and a molecular weight of 559.53 g/mol. Its IUPAC name is [(6S)-2-(cyclopropylmethyl)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate.
| Compound Name | [(6S)-2-(cyclopropylmethyl)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate |
|---|---|
| PubChem CID | 70339172 |
| Molecular Formula | C30H36Cl2N2O4 |
| Molecular Weight | 559.53 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | [(6S)-2-(cyclopropylmethyl)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate |
| SMILES | COc1cccc(C23CCN(CC4CC4)CC2(OC(C)=O)CC[C@H](NC(=O)Cc2ccc(Cl)c(Cl)c2)C3)c1 |
| InChI | InChI=1S/C30H36Cl2N2O4/c1-20(35)38-30-11-10-24(33-28(36)15-22-8-9-26(31)27(32)14-22)17-29(30,23-4-3-5-25(16-23)37-2)12-13-34(19-30)18-21-6-7-21/h3-5,8-9,14,16,21,24H,6-7,10-13,15,17-19H2,1-2H3,(H,33,36)/t24-,29?,30?/m0/s1 |
| InChIKey | MXZIKSBKSRUFES-VDOPKETPSA-N |
| XLogP | 5.57 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.53 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |