C29H36N2O4 — CID 70337393
[(4aS,6R,8aR)-6-benzamido-2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate (PubChem CID 70337393) has the molecular formula C29H36N2O4 and a molecular weight of 476.62 g/mol. Its IUPAC name is [(4aS,6R,8aR)-6-benzamido-2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate.
| Compound Name | [(4aS,6R,8aR)-6-benzamido-2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate |
|---|---|
| PubChem CID | 70337393 |
| Molecular Formula | C29H36N2O4 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | [(4aS,6R,8aR)-6-benzamido-2-(cyclopropylmethyl)-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate |
| SMILES | COc1cccc([C@@]23CCN(CC4CC4)C[C@@]2(OC(C)=O)CC[C@@H](NC(=O)c2ccccc2)C3)c1 |
| InChI | InChI=1S/C29H36N2O4/c1-21(32)35-29-14-13-25(30-27(33)23-7-4-3-5-8-23)18-28(29,24-9-6-10-26(17-24)34-2)15-16-31(20-29)19-22-11-12-22/h3-10,17,22,25H,11-16,18-20H2,1-2H3,(H,30,33)/t25-,28+,29+/m1/s1 |
| InChIKey | ARIQGZUWDOATMH-IGBKUBFESA-N |
| XLogP | 4.33 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |