C27H32N2O4 — CID 70337192
[(6R)-6-benzamido-4a-(3-hydroxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate (PubChem CID 70337192) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is [(6R)-6-benzamido-4a-(3-hydroxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate.
| Compound Name | [(6R)-6-benzamido-4a-(3-hydroxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate |
|---|---|
| PubChem CID | 70337192 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | [(6R)-6-benzamido-4a-(3-hydroxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate |
| SMILES | C=CCN1CCC2(c3cccc(O)c3)C[C@H](NC(=O)c3ccccc3)CCC2(OC(C)=O)C1 |
| InChI | InChI=1S/C27H32N2O4/c1-3-15-29-16-14-26(22-10-7-11-24(31)17-22)18-23(12-13-27(26,19-29)33-20(2)30)28-25(32)21-8-5-4-6-9-21/h3-11,17,23,31H,1,12-16,18-19H2,2H3,(H,28,32)/t23-,26?,27?/m1/s1 |
| InChIKey | OWVGUULMERPYMD-OMXGPXTPSA-N |
| XLogP | 3.81 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|