C24H30N2O3 — CID 19072110
N-[4a-(3-hydroxyphenyl)-8a-methoxy-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]benzamide (PubChem CID 19072110) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-[4a-(3-hydroxyphenyl)-8a-methoxy-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]benzamide.
| Compound Name | N-[4a-(3-hydroxyphenyl)-8a-methoxy-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]benzamide |
|---|---|
| PubChem CID | 19072110 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | N-[4a-(3-hydroxyphenyl)-8a-methoxy-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]benzamide |
| SMILES | COC12CCC(NC(=O)c3ccccc3)CC1(c1cccc(O)c1)CCN(C)C2 |
| InChI | InChI=1S/C24H30N2O3/c1-26-14-13-23(19-9-6-10-21(27)15-19)16-20(11-12-24(23,17-26)29-2)25-22(28)18-7-4-3-5-8-18/h3-10,15,20,27H,11-14,16-17H2,1-2H3,(H,25,28) |
| InChIKey | GRQTZMUTQRDDBH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |