C29H34N2O3 — CID 70340593
N-[(4aS,6S,8aR)-8a-methoxy-4a-(3-methoxyphenyl)-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]naphthalene-2-carboxamide (PubChem CID 70340593) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is N-[(4aS,6S,8aR)-8a-methoxy-4a-(3-methoxyphenyl)-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]naphthalene-2-carboxamide.
| Compound Name | N-[(4aS,6S,8aR)-8a-methoxy-4a-(3-methoxyphenyl)-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 70340593 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | N-[(4aS,6S,8aR)-8a-methoxy-4a-(3-methoxyphenyl)-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]naphthalene-2-carboxamide |
| SMILES | COc1cccc([C@@]23CCN(C)C[C@@]2(OC)CC[C@H](NC(=O)c2ccc4ccccc4c2)C3)c1 |
| InChI | InChI=1S/C29H34N2O3/c1-31-16-15-28(24-9-6-10-26(18-24)33-2)19-25(13-14-29(28,20-31)34-3)30-27(32)23-12-11-21-7-4-5-8-22(21)17-23/h4-12,17-18,25H,13-16,19-20H2,1-3H3,(H,30,32)/t25-,28-,29-/m0/s1 |
| InChIKey | WREUMXVFOROZHX-FMYROPPKSA-N |
| XLogP | 4.79 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |