C31H42N2O4 — CID 23211856
[3-[8a-methoxy-2-methyl-6-(6-phenylhexanoylamino)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate (PubChem CID 23211856) has the molecular formula C31H42N2O4 and a molecular weight of 506.69 g/mol. Its IUPAC name is [3-[8a-methoxy-2-methyl-6-(6-phenylhexanoylamino)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate.
| Compound Name | [3-[8a-methoxy-2-methyl-6-(6-phenylhexanoylamino)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 23211856 |
| Molecular Formula | C31H42N2O4 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | [3-[8a-methoxy-2-methyl-6-(6-phenylhexanoylamino)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate |
| SMILES | COC12CCC(NC(=O)CCCCCc3ccccc3)CC1(c1cccc(OC(C)=O)c1)CCN(C)C2 |
| InChI | InChI=1S/C31H42N2O4/c1-24(34)37-28-15-10-14-26(21-28)30-19-20-33(2)23-31(30,36-3)18-17-27(22-30)32-29(35)16-9-5-8-13-25-11-6-4-7-12-25/h4,6-7,10-12,14-15,21,27H,5,8-9,13,16-20,22-23H2,1-3H3,(H,32,35) |
| InChIKey | ADCXXCDACWIBED-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|