C29H33F3N2O4 — CID 56973915
[3-[8a-methoxy-2-methyl-6-[3-[3-(trifluoromethyl)phenyl]prop-2-enoylamino]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate (PubChem CID 56973915) has the molecular formula C29H33F3N2O4 and a molecular weight of 530.59 g/mol. Its IUPAC name is [3-[8a-methoxy-2-methyl-6-[3-[3-(trifluoromethyl)phenyl]prop-2-enoylamino]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate.
| Compound Name | [3-[8a-methoxy-2-methyl-6-[3-[3-(trifluoromethyl)phenyl]prop-2-enoylamino]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 56973915 |
| Molecular Formula | C29H33F3N2O4 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | [3-[8a-methoxy-2-methyl-6-[3-[3-(trifluoromethyl)phenyl]prop-2-enoylamino]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate |
| SMILES | COC12CCC(NC(=O)C=Cc3cccc(C(F)(F)F)c3)CC1(c1cccc(OC(C)=O)c1)CCN(C)C2 |
| InChI | InChI=1S/C29H33F3N2O4/c1-20(35)38-25-9-5-7-22(17-25)27-14-15-34(2)19-28(27,37-3)13-12-24(18-27)33-26(36)11-10-21-6-4-8-23(16-21)29(30,31)32/h4-11,16-17,24H,12-15,18-19H2,1-3H3,(H,33,36) |
| InChIKey | TWCWWHGTDOTFEQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|