C29H33F3N2O3 — CID 70337378
(E)-N-[2-(cyclopropylmethyl)-8a-hydroxy-4a-(3-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 70337378) has the molecular formula C29H33F3N2O3 and a molecular weight of 514.59 g/mol. Its IUPAC name is (E)-N-[2-(cyclopropylmethyl)-8a-hydroxy-4a-(3-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-(cyclopropylmethyl)-8a-hydroxy-4a-(3-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 70337378 |
| Molecular Formula | C29H33F3N2O3 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | (E)-N-[2-(cyclopropylmethyl)-8a-hydroxy-4a-(3-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(C(F)(F)F)c1)NC1CCC2(O)CN(CC3CC3)CCC2(c2cccc(O)c2)C1 |
| InChI | InChI=1S/C29H33F3N2O3/c30-29(31,32)23-5-1-3-20(15-23)9-10-26(36)33-24-11-12-28(37)19-34(18-21-7-8-21)14-13-27(28,17-24)22-4-2-6-25(35)16-22/h1-6,9-10,15-16,21,24,35,37H,7-8,11-14,17-19H2,(H,33,36)/b10-9+ |
| InChIKey | CRIICCPWVKPNFT-MDZDMXLPSA-N |
| XLogP | 4.88 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|