C30H38N2O4 — CID 70340384
N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-8a-hydroxy-4a-(3-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-(3-methoxyphenyl)-N-methylprop-2-enamide (PubChem CID 70340384) has the molecular formula C30H38N2O4 and a molecular weight of 490.64 g/mol. Its IUPAC name is N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-8a-hydroxy-4a-(3-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-(3-methoxyphenyl)-N-methylprop-2-enamide.
| Compound Name | N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-8a-hydroxy-4a-(3-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-(3-methoxyphenyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 70340384 |
| Molecular Formula | C30H38N2O4 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-8a-hydroxy-4a-(3-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-(3-methoxyphenyl)-N-methylprop-2-enamide |
| SMILES | COc1cccc(C=CC(=O)N(C)[C@@H]2CC[C@]3(O)CN(CC4CC4)CC[C@@]3(c3cccc(O)c3)C2)c1 |
| InChI | InChI=1S/C30H38N2O4/c1-31(28(34)12-11-22-5-3-8-27(17-22)36-2)25-13-14-30(35)21-32(20-23-9-10-23)16-15-29(30,19-25)24-6-4-7-26(33)18-24/h3-8,11-12,17-18,23,25,33,35H,9-10,13-16,19-21H2,1-2H3/t25-,29+,30+/m1/s1 |
| InChIKey | VOCARDVWRNGKSP-CPESWEKQSA-N |
| XLogP | 4.21 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|